C13H22O4 — CID 22853396
[(3S,4S)-3-hexyl-2-oxooxan-4-yl] acetate (PubChem CID 22853396) has the molecular formula C13H22O4 and a molecular weight of 242.31 g/mol. Its IUPAC name is [(3S,4S)-3-hexyl-2-oxooxan-4-yl] acetate.
| Compound Name | [(3S,4S)-3-hexyl-2-oxooxan-4-yl] acetate |
|---|---|
| PubChem CID | 22853396 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | [(3S,4S)-3-hexyl-2-oxooxan-4-yl] acetate |
| SMILES | CCCCCC[C@@H]1C(=O)OCC[C@@H]1OC(C)=O |
| InChI | InChI=1S/C13H22O4/c1-3-4-5-6-7-11-12(17-10(2)14)8-9-16-13(11)15/h11-12H,3-9H2,1-2H3/t11-,12-/m0/s1 |
| InChIKey | ZBKIDKBKXDKRJC-RYUDHWBXSA-N |
| XLogP | 2.45 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|