C17H24O4 — CID 11119887
[(2S,3S,5S)-5-(hydroxymethyl)-2-pentyloxolan-3-yl] benzoate (PubChem CID 11119887) has the molecular formula C17H24O4 and a molecular weight of 292.37 g/mol. Its IUPAC name is [(2S,3S,5S)-5-(hydroxymethyl)-2-pentyloxolan-3-yl] benzoate.
| Compound Name | [(2S,3S,5S)-5-(hydroxymethyl)-2-pentyloxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 11119887 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | [(2S,3S,5S)-5-(hydroxymethyl)-2-pentyloxolan-3-yl] benzoate |
| SMILES | CCCCC[C@@H]1O[C@H](CO)C[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C17H24O4/c1-2-3-5-10-15-16(11-14(12-18)20-15)21-17(19)13-8-6-4-7-9-13/h4,6-9,14-16,18H,2-3,5,10-12H2,1H3/t14-,15-,16-/m0/s1 |
| InChIKey | BVDGQSGNOIUYMV-JYJNAYRXSA-N |
| XLogP | 2.94 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|