C33H48O6 — CID 15814461
[(2R,3S,6R)-6-(4-hexoxyphenyl)-2-(hydroxymethyl)oxan-3-yl] 4-octoxybenzoate (PubChem CID 15814461) has the molecular formula C33H48O6 and a molecular weight of 540.74 g/mol. Its IUPAC name is [(2R,3S,6R)-6-(4-hexoxyphenyl)-2-(hydroxymethyl)oxan-3-yl] 4-octoxybenzoate.
| Compound Name | [(2R,3S,6R)-6-(4-hexoxyphenyl)-2-(hydroxymethyl)oxan-3-yl] 4-octoxybenzoate |
|---|---|
| PubChem CID | 15814461 |
| Molecular Formula | C33H48O6 |
| Molecular Weight | 540.74 g/mol |
| Exact Mass | 540.35 |
| IUPAC Name | [(2R,3S,6R)-6-(4-hexoxyphenyl)-2-(hydroxymethyl)oxan-3-yl] 4-octoxybenzoate |
| SMILES | CCCCCCCCOc1ccc(C(=O)O[C@H]2CC[C@H](c3ccc(OCCCCCC)cc3)O[C@@H]2CO)cc1 |
| InChI | InChI=1S/C33H48O6/c1-3-5-7-9-10-12-24-37-29-19-15-27(16-20-29)33(35)39-31-22-21-30(38-32(31)25-34)26-13-17-28(18-14-26)36-23-11-8-6-4-2/h13-20,30-32,34H,3-12,21-25H2,1-2H3/t30-,31+,32-/m1/s1 |
| InChIKey | OKOJWOKYBGZLSX-YKILCQELSA-N |
| XLogP | 7.82 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.74 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|