C26H40O4 — CID 11101790
[(2R,3S,5S)-5-[(1R)-1-hydroxydec-9-enyl]-2-pentyloxolan-3-yl] benzoate (PubChem CID 11101790) has the molecular formula C26H40O4 and a molecular weight of 416.60 g/mol. Its IUPAC name is [(2R,3S,5S)-5-[(1R)-1-hydroxydec-9-enyl]-2-pentyloxolan-3-yl] benzoate.
| Compound Name | [(2R,3S,5S)-5-[(1R)-1-hydroxydec-9-enyl]-2-pentyloxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 11101790 |
| Molecular Formula | C26H40O4 |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.29 |
| IUPAC Name | [(2R,3S,5S)-5-[(1R)-1-hydroxydec-9-enyl]-2-pentyloxolan-3-yl] benzoate |
| SMILES | C=CCCCCCCC[C@@H](O)[C@@H]1C[C@H](OC(=O)c2ccccc2)[C@@H](CCCCC)O1 |
| InChI | InChI=1S/C26H40O4/c1-3-5-7-8-9-10-15-18-22(27)24-20-25(23(29-24)19-12-6-4-2)30-26(28)21-16-13-11-14-17-21/h3,11,13-14,16-17,22-25,27H,1,4-10,12,15,18-20H2,2H3/t22-,23-,24+,25+/m1/s1 |
| InChIKey | FHJPDCBNMVYEJO-NGSHPTGOSA-N |
| XLogP | 6.23 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|