C19H36O3 — CID 11781945
(2S,3S,5R)-5-(1-hydroxydec-9-enyl)-2-pentyloxolan-3-ol (PubChem CID 11781945) has the molecular formula C19H36O3 and a molecular weight of 312.49 g/mol. Its IUPAC name is (2S,3S,5R)-5-(1-hydroxydec-9-enyl)-2-pentyloxolan-3-ol.
| Compound Name | (2S,3S,5R)-5-(1-hydroxydec-9-enyl)-2-pentyloxolan-3-ol |
|---|---|
| PubChem CID | 11781945 |
| Molecular Formula | C19H36O3 |
| Molecular Weight | 312.49 g/mol |
| Exact Mass | 312.27 |
| IUPAC Name | (2S,3S,5R)-5-(1-hydroxydec-9-enyl)-2-pentyloxolan-3-ol |
| SMILES | C=CCCCCCCCC(O)[C@H]1C[C@H](O)[C@H](CCCCC)O1 |
| InChI | InChI=1S/C19H36O3/c1-3-5-7-8-9-10-12-13-16(20)19-15-17(21)18(22-19)14-11-6-4-2/h3,16-21H,1,4-15H2,2H3/t16?,17-,18-,19+/m0/s1 |
| InChIKey | ZPHRIOPZYRKRRG-HRVKUGKESA-N |
| XLogP | 4.36 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.49 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|