C21H36O5 — CID 91121807
methyl 11-hydroxy-11-[(2R,5R)-4-hydroxy-5-pentyloxolan-2-yl]undeca-5,8-dienoate (PubChem CID 91121807) has the molecular formula C21H36O5 and a molecular weight of 368.51 g/mol. Its IUPAC name is methyl 11-hydroxy-11-[(2R,5R)-4-hydroxy-5-pentyloxolan-2-yl]undeca-5,8-dienoate.
| Compound Name | methyl 11-hydroxy-11-[(2R,5R)-4-hydroxy-5-pentyloxolan-2-yl]undeca-5,8-dienoate |
|---|---|
| PubChem CID | 91121807 |
| Molecular Formula | C21H36O5 |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.26 |
| IUPAC Name | methyl 11-hydroxy-11-[(2R,5R)-4-hydroxy-5-pentyloxolan-2-yl]undeca-5,8-dienoate |
| SMILES | CCCCC[C@H]1O[C@@H](C(O)CC=CCC=CCCCC(=O)OC)CC1O |
| InChI | InChI=1S/C21H36O5/c1-3-4-10-14-19-18(23)16-20(26-19)17(22)13-11-8-6-5-7-9-12-15-21(24)25-2/h5,7-8,11,17-20,22-23H,3-4,6,9-10,12-16H2,1-2H3/t17?,18?,19-,20-/m1/s1 |
| InChIKey | SCGUGWCBFXDWNE-NTFDOXNWSA-N |
| XLogP | 3.68 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|