C21H36O5 — CID 11610350
methyl (5Z,8Z,11R,12E,14R,15S)-11,14,15-trihydroxyicosa-5,8,12-trienoate (PubChem CID 11610350) has the molecular formula C21H36O5 and a molecular weight of 368.51 g/mol. Its IUPAC name is methyl (5Z,8Z,11R,12E,14R,15S)-11,14,15-trihydroxyicosa-5,8,12-trienoate.
| Compound Name | methyl (5Z,8Z,11R,12E,14R,15S)-11,14,15-trihydroxyicosa-5,8,12-trienoate |
|---|---|
| PubChem CID | 11610350 |
| Molecular Formula | C21H36O5 |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.26 |
| IUPAC Name | methyl (5Z,8Z,11R,12E,14R,15S)-11,14,15-trihydroxyicosa-5,8,12-trienoate |
| SMILES | CCCCC[C@H](O)[C@H](O)/C=C/[C@H](O)C/C=C\C/C=C\CCCC(=O)OC |
| InChI | InChI=1S/C21H36O5/c1-3-4-10-14-19(23)20(24)17-16-18(22)13-11-8-6-5-7-9-12-15-21(25)26-2/h5,7-8,11,16-20,22-24H,3-4,6,9-10,12-15H2,1-2H3/b7-5-,11-8-,17-16+/t18-,19+,20-/m1/s1 |
| InChIKey | XEUHXGNYQTTXAD-PLNZLUCXSA-N |
| XLogP | 3.44 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|