C19H36O5 — CID 10315496
methyl (E)-9,10,13-trihydroxyoctadec-11-enoate (PubChem CID 10315496) has the molecular formula C19H36O5 and a molecular weight of 344.49 g/mol. Its IUPAC name is methyl (E)-9,10,13-trihydroxyoctadec-11-enoate.
| Compound Name | methyl (E)-9,10,13-trihydroxyoctadec-11-enoate |
|---|---|
| PubChem CID | 10315496 |
| Molecular Formula | C19H36O5 |
| Molecular Weight | 344.49 g/mol |
| Exact Mass | 344.26 |
| IUPAC Name | methyl (E)-9,10,13-trihydroxyoctadec-11-enoate |
| SMILES | CCCCCC(O)/C=C/C(O)C(O)CCCCCCCC(=O)OC |
| InChI | InChI=1S/C19H36O5/c1-3-4-8-11-16(20)14-15-18(22)17(21)12-9-6-5-7-10-13-19(23)24-2/h14-18,20-22H,3-13H2,1-2H3/b15-14+ |
| InChIKey | QGWDHSLORIPFKF-CCEZHUSRSA-N |
| XLogP | 3.11 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.49 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|