methyl (E)-9,10,13-trihydroxyoctadec-11-enoate

C19H36O5 — CID 10315496

IUPACmethyl (E)-9,10,13-trihydroxyoctadec-11-enoate
SMILESCCCCCC(O)/C=C/C(O)C(O)CCCCCCCC(=O)OC
InChIInChI=1S/C19H36O5/c1-3-4-8-11-16(20)14-15-18(22)17(21)12-9-6-5-7-10-13-19(23)24-2/h14-18,20-22H,3-13H2,1-2H3/b15-14+
InChIKeyQGWDHSLORIPFKF-CCEZHUSRSA-N
MW344.49 g/mol
LogP3.11
Rot. Bonds15

About methyl (E)-9,10,13-trihydroxyoctadec-11-enoate

methyl (E)-9,10,13-trihydroxyoctadec-11-enoate (PubChem CID 10315496) has the molecular formula C19H36O5 and a molecular weight of 344.49 g/mol. Its IUPAC name is methyl (E)-9,10,13-trihydroxyoctadec-11-enoate.

Molecular Properties

Compound Namemethyl (E)-9,10,13-trihydroxyoctadec-11-enoate
PubChem CID10315496
Molecular FormulaC19H36O5
Molecular Weight344.49 g/mol
Exact Mass344.26
IUPAC Namemethyl (E)-9,10,13-trihydroxyoctadec-11-enoate
SMILESCCCCCC(O)/C=C/C(O)C(O)CCCCCCCC(=O)OC
InChIInChI=1S/C19H36O5/c1-3-4-8-11-16(20)14-15-18(22)17(21)12-9-6-5-7-10-13-19(23)24-2/h14-18,20-22H,3-13H2,1-2H3/b15-14+
InChIKeyQGWDHSLORIPFKF-CCEZHUSRSA-N
XLogP3.11
TPSA86.99 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds15
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500344.49
LogP ≤ 53.11
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze methyl (E)-9,10,13-trihydroxyoctadec-11-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (E)-9,10,13-trihydroxyoctadec-11-enoate?
The IUPAC name of methyl (E)-9,10,13-trihydroxyoctadec-11-enoate (CID 10315496) is methyl (E)-9,10,13-trihydroxyoctadec-11-enoate.
What is the SMILES notation for methyl (E)-9,10,13-trihydroxyoctadec-11-enoate?
The canonical SMILES for methyl (E)-9,10,13-trihydroxyoctadec-11-enoate is CCCCCC(O)/C=C/C(O)C(O)CCCCCCCC(=O)OC.
What is the InChIKey of methyl (E)-9,10,13-trihydroxyoctadec-11-enoate?
The InChIKey is QGWDHSLORIPFKF-CCEZHUSRSA-N. The full InChI is InChI=1S/C19H36O5/c1-3-4-8-11-16(20)14-15-18(22)17(21)12-9-6-5-7-10-13-19(23)24-2/h14-18,20-22H,3-13H2,1-2H3/b15-14+.
What are the key properties of methyl (E)-9,10,13-trihydroxyoctadec-11-enoate?
methyl (E)-9,10,13-trihydroxyoctadec-11-enoate has a molecular weight of 344.49 g/mol, XLogP of 3.11, 15 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-9,10,13-trihydroxyoctadec-11-enoate is sourced from PubChem (CID 10315496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).