C21H40O7 — CID 73112701
2,3-dihydroxypropyl 8,11,12-trihydroxyoctadec-9-enoate (PubChem CID 73112701) has the molecular formula C21H40O7 and a molecular weight of 404.54 g/mol. Its IUPAC name is 2,3-dihydroxypropyl 8,11,12-trihydroxyoctadec-9-enoate.
| Compound Name | 2,3-dihydroxypropyl 8,11,12-trihydroxyoctadec-9-enoate |
|---|---|
| PubChem CID | 73112701 |
| Molecular Formula | C21H40O7 |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.28 |
| IUPAC Name | 2,3-dihydroxypropyl 8,11,12-trihydroxyoctadec-9-enoate |
| SMILES | CCCCCCC(O)C(O)C=CC(O)CCCCCCC(=O)OCC(O)CO |
| InChI | InChI=1S/C21H40O7/c1-2-3-4-8-11-19(25)20(26)14-13-17(23)10-7-5-6-9-12-21(27)28-16-18(24)15-22/h13-14,17-20,22-26H,2-12,15-16H2,1H3 |
| InChIKey | CCCZMBNHXALALI-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|