C20H32O5 — CID 171118583
(5Z,8Z,11Z,14R,15E,17R,18R)-14,17,18-trihydroxyicosa-5,8,11,15-tetraenoic acid (PubChem CID 171118583) has the molecular formula C20H32O5 and a molecular weight of 352.47 g/mol. Its IUPAC name is (5Z,8Z,11Z,14R,15E,17R,18R)-14,17,18-trihydroxyicosa-5,8,11,15-tetraenoic acid.
| Compound Name | (5Z,8Z,11Z,14R,15E,17R,18R)-14,17,18-trihydroxyicosa-5,8,11,15-tetraenoic acid |
|---|---|
| PubChem CID | 171118583 |
| Molecular Formula | C20H32O5 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | (5Z,8Z,11Z,14R,15E,17R,18R)-14,17,18-trihydroxyicosa-5,8,11,15-tetraenoic acid |
| SMILES | CC[C@@H](O)[C@H](O)/C=C/[C@H](O)C/C=C\C/C=C\C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H32O5/c1-2-18(22)19(23)16-15-17(21)13-11-9-7-5-3-4-6-8-10-12-14-20(24)25/h3,5-6,8-9,11,15-19,21-23H,2,4,7,10,12-14H2,1H3,(H,24,25)/b5-3-,8-6-,11-9-,16-15+/t17-,18-,19-/m1/s1 |
| InChIKey | FHKYIIAOBKDGDK-AMWNYCQBSA-N |
| XLogP | 3.13 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|