C15H30O3 — CID 10777626
(2R,3R,5R)-5-[(1R)-1-hydroxyhexyl]-2-pentyloxolan-3-ol (PubChem CID 10777626) has the molecular formula C15H30O3 and a molecular weight of 258.40 g/mol. Its IUPAC name is (2R,3R,5R)-5-[(1R)-1-hydroxyhexyl]-2-pentyloxolan-3-ol.
| Compound Name | (2R,3R,5R)-5-[(1R)-1-hydroxyhexyl]-2-pentyloxolan-3-ol |
|---|---|
| PubChem CID | 10777626 |
| Molecular Formula | C15H30O3 |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.22 |
| IUPAC Name | (2R,3R,5R)-5-[(1R)-1-hydroxyhexyl]-2-pentyloxolan-3-ol |
| SMILES | CCCCC[C@@H](O)[C@H]1C[C@@H](O)[C@@H](CCCCC)O1 |
| InChI | InChI=1S/C15H30O3/c1-3-5-7-9-12(16)15-11-13(17)14(18-15)10-8-6-4-2/h12-17H,3-11H2,1-2H3/t12-,13-,14-,15-/m1/s1 |
| InChIKey | BMOSUOZFWIWDFT-KBUPBQIOSA-N |
| XLogP | 3.03 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|