C10H18O3 — CID 42642816
(2S,4S,5S)-4-hydroxy-5-pentyloxolane-2-carbaldehyde (PubChem CID 42642816) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is (2S,4S,5S)-4-hydroxy-5-pentyloxolane-2-carbaldehyde.
| Compound Name | (2S,4S,5S)-4-hydroxy-5-pentyloxolane-2-carbaldehyde |
|---|---|
| PubChem CID | 42642816 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | (2S,4S,5S)-4-hydroxy-5-pentyloxolane-2-carbaldehyde |
| SMILES | CCCCC[C@@H]1O[C@H](C=O)C[C@@H]1O |
| InChI | InChI=1S/C10H18O3/c1-2-3-4-5-10-9(12)6-8(7-11)13-10/h7-10,12H,2-6H2,1H3/t8-,9-,10-/m0/s1 |
| InChIKey | WLNKYTTYAJFMLP-GUBZILKMSA-N |
| XLogP | 1.28 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|