C8H14O3 — CID 45084926
(2S,3R)-3-pentyloxirane-2-carboxylic acid (PubChem CID 45084926) has the molecular formula C8H14O3 and a molecular weight of 158.20 g/mol. Its IUPAC name is (2S,3R)-3-pentyloxirane-2-carboxylic acid.
| Compound Name | (2S,3R)-3-pentyloxirane-2-carboxylic acid |
|---|---|
| PubChem CID | 45084926 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | (2S,3R)-3-pentyloxirane-2-carboxylic acid |
| SMILES | CCCCC[C@H]1O[C@@H]1C(=O)O |
| InChI | InChI=1S/C8H14O3/c1-2-3-4-5-6-7(11-6)8(9)10/h6-7H,2-5H2,1H3,(H,9,10)/t6-,7+/m1/s1 |
| InChIKey | VCWSTSRUGKXXQI-RQJHMYQMSA-N |
| XLogP | 1.42 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|