C14H26O2 — CID 87794847
1-[(2S,3R)-3-heptyloxiran-2-yl]-2,2-dimethylpropan-1-one (PubChem CID 87794847) has the molecular formula C14H26O2 and a molecular weight of 226.36 g/mol. Its IUPAC name is 1-[(2S,3R)-3-heptyloxiran-2-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[(2S,3R)-3-heptyloxiran-2-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 87794847 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | 1-[(2S,3R)-3-heptyloxiran-2-yl]-2,2-dimethylpropan-1-one |
| SMILES | CCCCCCC[C@H]1O[C@@H]1C(=O)C(C)(C)C |
| InChI | InChI=1S/C14H26O2/c1-5-6-7-8-9-10-11-12(16-11)13(15)14(2,3)4/h11-12H,5-10H2,1-4H3/t11-,12+/m1/s1 |
| InChIKey | WNHPNWZNOVONFU-NEPJUHHUSA-N |
| XLogP | 3.73 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|