C14H26O2 — CID 101212240
1-[(2S,3R)-3-decyloxiran-2-yl]ethanone (PubChem CID 101212240) has the molecular formula C14H26O2 and a molecular weight of 226.36 g/mol. Its IUPAC name is 1-[(2S,3R)-3-decyloxiran-2-yl]ethanone.
| Compound Name | 1-[(2S,3R)-3-decyloxiran-2-yl]ethanone |
|---|---|
| PubChem CID | 101212240 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | 1-[(2S,3R)-3-decyloxiran-2-yl]ethanone |
| SMILES | CCCCCCCCCC[C@H]1O[C@@H]1C(C)=O |
| InChI | InChI=1S/C14H26O2/c1-3-4-5-6-7-8-9-10-11-13-14(16-13)12(2)15/h13-14H,3-11H2,1-2H3/t13-,14-/m1/s1 |
| InChIKey | GRIJPISWASAAOL-ZIAGYGMSSA-N |
| XLogP | 3.87 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|