C19H37NO2 — CID 10638801
(2R,3S)-3-dodecyl-N,N-diethyloxirane-2-carboxamide (PubChem CID 10638801) has the molecular formula C19H37NO2 and a molecular weight of 311.51 g/mol. Its IUPAC name is (2R,3S)-3-dodecyl-N,N-diethyloxirane-2-carboxamide.
| Compound Name | (2R,3S)-3-dodecyl-N,N-diethyloxirane-2-carboxamide |
|---|---|
| PubChem CID | 10638801 |
| Molecular Formula | C19H37NO2 |
| Molecular Weight | 311.51 g/mol |
| Exact Mass | 311.28 |
| IUPAC Name | (2R,3S)-3-dodecyl-N,N-diethyloxirane-2-carboxamide |
| SMILES | CCCCCCCCCCCC[C@@H]1O[C@H]1C(=O)N(CC)CC |
| InChI | InChI=1S/C19H37NO2/c1-4-7-8-9-10-11-12-13-14-15-16-17-18(22-17)19(21)20(5-2)6-3/h17-18H,4-16H2,1-3H3/t17-,18+/m0/s1 |
| InChIKey | UINNSWONWJRCGR-ZWKOTPCHSA-N |
| XLogP | 4.93 |
| TPSA | 32.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.51 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|