C15H29NO — CID 102327285
cis-(1S,2S)-N,N-diethyl-2-heptylcyclopropane-1-carboxamide (PubChem CID 102327285) has the molecular formula C15H29NO and a molecular weight of 239.40 g/mol. Its IUPAC name is cis-(1S,2S)-N,N-diethyl-2-heptylcyclopropane-1-carboxamide.
| Compound Name | cis-(1S,2S)-N,N-diethyl-2-heptylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 102327285 |
| Molecular Formula | C15H29NO |
| Molecular Weight | 239.40 g/mol |
| Exact Mass | 239.22 |
| IUPAC Name | cis-(1S,2S)-N,N-diethyl-2-heptylcyclopropane-1-carboxamide |
| SMILES | CCCCCCC[C@H]1C[C@@H]1C(=O)N(CC)CC |
| InChI | InChI=1S/C15H29NO/c1-4-7-8-9-10-11-13-12-14(13)15(17)16(5-2)6-3/h13-14H,4-12H2,1-3H3/t13-,14-/m0/s1 |
| InChIKey | ZLDVMBIPOIWFEM-KBPBESRZSA-N |
| XLogP | 3.85 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.40 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|