About 1-[(1S,2R)-2-tetradecylcyclopropyl]hexan-1-one
1-[(1S,2R)-2-tetradecylcyclopropyl]hexan-1-one (PubChem CID 101388120) has the molecular formula C23H44O
and a molecular weight of 336.60 g/mol. Its IUPAC name is 1-[(1S,2R)-2-tetradecylcyclopropyl]hexan-1-one.
Molecular Properties
| Compound Name | 1-[(1S,2R)-2-tetradecylcyclopropyl]hexan-1-one |
| PubChem CID | 101388120 |
| Molecular Formula | C23H44O |
| Molecular Weight | 336.60 g/mol |
| Exact Mass | 336.34 |
| IUPAC Name | 1-[(1S,2R)-2-tetradecylcyclopropyl]hexan-1-one |
| SMILES | CCCCCCCCCCCCCC[C@@H]1C[C@@H]1C(=O)CCCCC |
| InChI | InChI=1S/C23H44O/c1-3-5-7-8-9-10-11-12-13-14-15-17-18-21-20-22(21)23(24)19-16-6-4-2/h21-22H,3-20H2,1-2H3/t21-,22+/m1/s1 |
| InChIKey | ZKSDYMYCJKLUNQ-YADHBBJMSA-N |
| XLogP | 7.86 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.60 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1S,2R)-2-tetradecylcyclopropyl]hexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1S,2R)-2-tetradecylcyclopropyl]hexan-1-one?
The IUPAC name of 1-[(1S,2R)-2-tetradecylcyclopropyl]hexan-1-one (CID 101388120) is 1-[(1S,2R)-2-tetradecylcyclopropyl]hexan-1-one.
What is the SMILES notation for 1-[(1S,2R)-2-tetradecylcyclopropyl]hexan-1-one?
The canonical SMILES for 1-[(1S,2R)-2-tetradecylcyclopropyl]hexan-1-one is CCCCCCCCCCCCCC[C@@H]1C[C@@H]1C(=O)CCCCC.
What is the InChIKey of 1-[(1S,2R)-2-tetradecylcyclopropyl]hexan-1-one?
The InChIKey is ZKSDYMYCJKLUNQ-YADHBBJMSA-N. The full InChI is InChI=1S/C23H44O/c1-3-5-7-8-9-10-11-12-13-14-15-17-18-21-20-22(21)23(24)19-16-6-4-2/h21-22H,3-20H2,1-2H3/t21-,22+/m1/s1.
What are the key properties of 1-[(1S,2R)-2-tetradecylcyclopropyl]hexan-1-one?
1-[(1S,2R)-2-tetradecylcyclopropyl]hexan-1-one has a molecular weight of 336.60 g/mol, XLogP of 7.86, 18 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1S,2R)-2-tetradecylcyclopropyl]hexan-1-one is sourced from PubChem (CID 101388120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).