C16H30O — CID 134964567
1-[(1R,2R)-2-methylcyclopropyl]dodecan-1-one (PubChem CID 134964567) has the molecular formula C16H30O and a molecular weight of 238.41 g/mol. Its IUPAC name is 1-[(1R,2R)-2-methylcyclopropyl]dodecan-1-one.
| Compound Name | 1-[(1R,2R)-2-methylcyclopropyl]dodecan-1-one |
|---|---|
| PubChem CID | 134964567 |
| Molecular Formula | C16H30O |
| Molecular Weight | 238.41 g/mol |
| Exact Mass | 238.23 |
| IUPAC Name | 1-[(1R,2R)-2-methylcyclopropyl]dodecan-1-one |
| SMILES | CCCCCCCCCCCC(=O)[C@@H]1C[C@H]1C |
| InChI | InChI=1S/C16H30O/c1-3-4-5-6-7-8-9-10-11-12-16(17)15-13-14(15)2/h14-15H,3-13H2,1-2H3/t14-,15-/m1/s1 |
| InChIKey | BMEIMMXIFKCHOT-HUUCEWRRSA-N |
| XLogP | 5.13 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.41 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|