C22H38O3 — CID 22816193
2-[5-[(2R,3R)-3-octyl-5-oxabicyclo[2.1.1]hexan-2-yl]pentyl]cyclopropane-1-carboxylic acid (PubChem CID 22816193) has the molecular formula C22H38O3 and a molecular weight of 350.54 g/mol. Its IUPAC name is 2-[5-[(2R,3R)-3-octyl-5-oxabicyclo[2.1.1]hexan-2-yl]pentyl]cyclopropane-1-carboxylic acid.
| Compound Name | 2-[5-[(2R,3R)-3-octyl-5-oxabicyclo[2.1.1]hexan-2-yl]pentyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 22816193 |
| Molecular Formula | C22H38O3 |
| Molecular Weight | 350.54 g/mol |
| Exact Mass | 350.28 |
| IUPAC Name | 2-[5-[(2R,3R)-3-octyl-5-oxabicyclo[2.1.1]hexan-2-yl]pentyl]cyclopropane-1-carboxylic acid |
| SMILES | CCCCCCCC[C@H]1C2CC(O2)[C@@H]1CCCCCC1CC1C(=O)O |
| InChI | InChI=1S/C22H38O3/c1-2-3-4-5-6-9-12-17-18(21-15-20(17)25-21)13-10-7-8-11-16-14-19(16)22(23)24/h16-21H,2-15H2,1H3,(H,23,24)/t16?,17-,18-,19?,20?,21?/m1/s1 |
| InChIKey | KFZHIEZGPKHPQG-PWDWLHCNSA-N |
| XLogP | 5.81 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.54 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|