C11H22O4 — CID 91192531
2-(hydroxymethyl)-6-pentyloxane-3,4-diol (PubChem CID 91192531) has the molecular formula C11H22O4 and a molecular weight of 218.29 g/mol. Its IUPAC name is 2-(hydroxymethyl)-6-pentyloxane-3,4-diol.
| Compound Name | 2-(hydroxymethyl)-6-pentyloxane-3,4-diol |
|---|---|
| PubChem CID | 91192531 |
| Molecular Formula | C11H22O4 |
| Molecular Weight | 218.29 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 2-(hydroxymethyl)-6-pentyloxane-3,4-diol |
| SMILES | CCCCCC1CC(O)C(O)C(CO)O1 |
| InChI | InChI=1S/C11H22O4/c1-2-3-4-5-8-6-9(13)11(14)10(7-12)15-8/h8-14H,2-7H2,1H3 |
| InChIKey | AFPVTSFVQGZKAL-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.29 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|