C21H40O6 — CID 70658840
2-(5-butyl-2-hydroxy-4-pentylcyclohexyl)-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 70658840) has the molecular formula C21H40O6 and a molecular weight of 388.55 g/mol. Its IUPAC name is 2-(5-butyl-2-hydroxy-4-pentylcyclohexyl)-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | 2-(5-butyl-2-hydroxy-4-pentylcyclohexyl)-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 70658840 |
| Molecular Formula | C21H40O6 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.28 |
| IUPAC Name | 2-(5-butyl-2-hydroxy-4-pentylcyclohexyl)-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCCCCC1CC(O)C(C2OC(CO)C(O)C(O)C2O)CC1CCCC |
| InChI | InChI=1S/C21H40O6/c1-3-5-7-9-14-11-16(23)15(10-13(14)8-6-4-2)21-20(26)19(25)18(24)17(12-22)27-21/h13-26H,3-12H2,1-2H3 |
| InChIKey | MXLLUQKGOSITSQ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|