C21H38O6 — CID 70658853
(2S,4R,5S)-4-butyl-5-pentyl-2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]cyclohexan-1-one (PubChem CID 70658853) has the molecular formula C21H38O6 and a molecular weight of 386.53 g/mol. Its IUPAC name is (2S,4R,5S)-4-butyl-5-pentyl-2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]cyclohexan-1-one.
| Compound Name | (2S,4R,5S)-4-butyl-5-pentyl-2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]cyclohexan-1-one |
|---|---|
| PubChem CID | 70658853 |
| Molecular Formula | C21H38O6 |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.27 |
| IUPAC Name | (2S,4R,5S)-4-butyl-5-pentyl-2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]cyclohexan-1-one |
| SMILES | CCCCC[C@H]1CC(=O)[C@H](C2OC(CO)C(O)C(O)C2O)C[C@H]1CCCC |
| InChI | InChI=1S/C21H38O6/c1-3-5-7-9-14-11-16(23)15(10-13(14)8-6-4-2)21-20(26)19(25)18(24)17(12-22)27-21/h13-15,17-22,24-26H,3-12H2,1-2H3/t13-,14+,15-,17?,18?,19?,20?,21?/m1/s1 |
| InChIKey | WECKPJKEDHUGQZ-DCRCDSMYSA-N |
| XLogP | 1.81 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|