C13H28O5 — CID 145127293
ethane;2-(hydroxymethyl)-6-pentoxyoxane-3,4-diol (PubChem CID 145127293) has the molecular formula C13H28O5 and a molecular weight of 264.36 g/mol. Its IUPAC name is ethane;2-(hydroxymethyl)-6-pentoxyoxane-3,4-diol.
| Compound Name | ethane;2-(hydroxymethyl)-6-pentoxyoxane-3,4-diol |
|---|---|
| PubChem CID | 145127293 |
| Molecular Formula | C13H28O5 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.19 |
| IUPAC Name | ethane;2-(hydroxymethyl)-6-pentoxyoxane-3,4-diol |
| SMILES | CC.CCCCCOC1CC(O)C(O)C(CO)O1 |
| InChI | InChI=1S/C11H22O5.C2H6/c1-2-3-4-5-15-10-6-8(13)11(14)9(7-12)16-10;1-2/h8-14H,2-7H2,1H3;1-2H3 |
| InChIKey | QITORWKQWRMKRM-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|