C17H34O6 — CID 13365350
(3R,4S,5R,6R)-6-(hydroxymethyl)-4-undecoxyoxane-2,3,5-triol (PubChem CID 13365350) has the molecular formula C17H34O6 and a molecular weight of 334.45 g/mol. Its IUPAC name is (3R,4S,5R,6R)-6-(hydroxymethyl)-4-undecoxyoxane-2,3,5-triol.
| Compound Name | (3R,4S,5R,6R)-6-(hydroxymethyl)-4-undecoxyoxane-2,3,5-triol |
|---|---|
| PubChem CID | 13365350 |
| Molecular Formula | C17H34O6 |
| Molecular Weight | 334.45 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | (3R,4S,5R,6R)-6-(hydroxymethyl)-4-undecoxyoxane-2,3,5-triol |
| SMILES | CCCCCCCCCCCO[C@H]1[C@H](O)[C@@H](CO)OC(O)[C@@H]1O |
| InChI | InChI=1S/C17H34O6/c1-2-3-4-5-6-7-8-9-10-11-22-16-14(19)13(12-18)23-17(21)15(16)20/h13-21H,2-12H2,1H3/t13-,14-,15-,16+,17?/m1/s1 |
| InChIKey | MLGMKKRBJHNJTO-DNLWUEFJSA-N |
| XLogP | 1.33 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.45 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|