C21H42O6 — CID 173460105
(3R,4S,5R,6R)-6-(hydroxymethyl)-3,4,5-tripentoxyoxan-2-ol (PubChem CID 173460105) has the molecular formula C21H42O6 and a molecular weight of 390.56 g/mol. Its IUPAC name is (3R,4S,5R,6R)-6-(hydroxymethyl)-3,4,5-tripentoxyoxan-2-ol.
| Compound Name | (3R,4S,5R,6R)-6-(hydroxymethyl)-3,4,5-tripentoxyoxan-2-ol |
|---|---|
| PubChem CID | 173460105 |
| Molecular Formula | C21H42O6 |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.30 |
| IUPAC Name | (3R,4S,5R,6R)-6-(hydroxymethyl)-3,4,5-tripentoxyoxan-2-ol |
| SMILES | CCCCCO[C@H]1[C@H](OCCCCC)[C@@H](OCCCCC)C(O)O[C@@H]1CO |
| InChI | InChI=1S/C21H42O6/c1-4-7-10-13-24-18-17(16-22)27-21(23)20(26-15-12-9-6-3)19(18)25-14-11-8-5-2/h17-23H,4-16H2,1-3H3/t17-,18-,19+,20-,21?/m1/s1 |
| InChIKey | LPNWYBMBQHZNBB-AWGDKMGJSA-N |
| XLogP | 3.42 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|