C17H34O5 — CID 66641660
(3R,4R,5R)-3,4-dibutoxy-5-(butoxymethyl)oxolan-2-ol (PubChem CID 66641660) has the molecular formula C17H34O5 and a molecular weight of 318.45 g/mol. Its IUPAC name is (3R,4R,5R)-3,4-dibutoxy-5-(butoxymethyl)oxolan-2-ol.
| Compound Name | (3R,4R,5R)-3,4-dibutoxy-5-(butoxymethyl)oxolan-2-ol |
|---|---|
| PubChem CID | 66641660 |
| Molecular Formula | C17H34O5 |
| Molecular Weight | 318.45 g/mol |
| Exact Mass | 318.24 |
| IUPAC Name | (3R,4R,5R)-3,4-dibutoxy-5-(butoxymethyl)oxolan-2-ol |
| SMILES | CCCCOC[C@H]1OC(O)[C@H](OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C17H34O5/c1-4-7-10-19-13-14-15(20-11-8-5-2)16(17(18)22-14)21-12-9-6-3/h14-18H,4-13H2,1-3H3/t14-,15-,16-,17?/m1/s1 |
| InChIKey | KIANHVWOADXBKN-HJNZIYBASA-N |
| XLogP | 2.89 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.45 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|