C20H39BrO4 — CID 70484423
(2R,3R,4S,5S)-2-bromo-3,4-dipentoxy-5-(pentoxymethyl)oxolane (PubChem CID 70484423) has the molecular formula C20H39BrO4 and a molecular weight of 423.43 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2-bromo-3,4-dipentoxy-5-(pentoxymethyl)oxolane.
| Compound Name | (2R,3R,4S,5S)-2-bromo-3,4-dipentoxy-5-(pentoxymethyl)oxolane |
|---|---|
| PubChem CID | 70484423 |
| Molecular Formula | C20H39BrO4 |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | (2R,3R,4S,5S)-2-bromo-3,4-dipentoxy-5-(pentoxymethyl)oxolane |
| SMILES | CCCCCOC[C@@H]1O[C@H](Br)[C@H](OCCCCC)[C@H]1OCCCCC |
| InChI | InChI=1S/C20H39BrO4/c1-4-7-10-13-22-16-17-18(23-14-11-8-5-2)19(20(21)25-17)24-15-12-9-6-3/h17-20H,4-16H2,1-3H3/t17-,18-,19+,20-/m0/s1 |
| InChIKey | QQVMHLRGMJSJKB-HAGHYFMRSA-N |
| XLogP | 5.46 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|