C23H38O6 — CID 121434721
(3R,4R,5R,6R)-4-pentoxy-6-(pentoxymethyl)-5-phenylmethoxyoxane-2,3-diol (PubChem CID 121434721) has the molecular formula C23H38O6 and a molecular weight of 410.55 g/mol. Its IUPAC name is (3R,4R,5R,6R)-4-pentoxy-6-(pentoxymethyl)-5-phenylmethoxyoxane-2,3-diol.
| Compound Name | (3R,4R,5R,6R)-4-pentoxy-6-(pentoxymethyl)-5-phenylmethoxyoxane-2,3-diol |
|---|---|
| PubChem CID | 121434721 |
| Molecular Formula | C23H38O6 |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.27 |
| IUPAC Name | (3R,4R,5R,6R)-4-pentoxy-6-(pentoxymethyl)-5-phenylmethoxyoxane-2,3-diol |
| SMILES | CCCCCOC[C@H]1OC(O)[C@H](O)[C@@H](OCCCCC)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C23H38O6/c1-3-5-10-14-26-17-19-21(28-16-18-12-8-7-9-13-18)22(20(24)23(25)29-19)27-15-11-6-4-2/h7-9,12-13,19-25H,3-6,10-11,14-17H2,1-2H3/t19-,20-,21-,22-,23?/m1/s1 |
| InChIKey | XPSKFSHNVWVEOJ-CDFDCGRVSA-N |
| XLogP | 3.43 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|