C33H40O5 — CID 177482911
(2R,3S,4R,5R,6R)-2-[(Z)-hex-1-enyl]-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-ol (PubChem CID 177482911) has the molecular formula C33H40O5 and a molecular weight of 516.68 g/mol. Its IUPAC name is (2R,3S,4R,5R,6R)-2-[(Z)-hex-1-enyl]-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-ol.
| Compound Name | (2R,3S,4R,5R,6R)-2-[(Z)-hex-1-enyl]-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-ol |
|---|---|
| PubChem CID | 177482911 |
| Molecular Formula | C33H40O5 |
| Molecular Weight | 516.68 g/mol |
| Exact Mass | 516.29 |
| IUPAC Name | (2R,3S,4R,5R,6R)-2-[(Z)-hex-1-enyl]-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-ol |
| SMILES | CCCC/C=C\[C@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1O |
| InChI | InChI=1S/C33H40O5/c1-2-3-4-14-21-29-31(34)33(37-24-28-19-12-7-13-20-28)32(36-23-27-17-10-6-11-18-27)30(38-29)25-35-22-26-15-8-5-9-16-26/h5-21,29-34H,2-4,22-25H2,1H3/b21-14-/t29-,30-,31+,32-,33-/m1/s1 |
| InChIKey | NIXAXKUIGAUDJM-VICHUHBKSA-N |
| XLogP | 6.25 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.68 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|