C47H54O6Si — CID 11251211
(2R,3S,4R,5R,6R)-2-[(E)-4-[tert-butyl(diphenyl)silyl]oxybut-1-enyl]-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-ol (PubChem CID 11251211) has the molecular formula C47H54O6Si and a molecular weight of 743.03 g/mol. Its IUPAC name is (2R,3S,4R,5R,6R)-2-[(E)-4-[tert-butyl(diphenyl)silyl]oxybut-1-enyl]-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-ol.
| Compound Name | (2R,3S,4R,5R,6R)-2-[(E)-4-[tert-butyl(diphenyl)silyl]oxybut-1-enyl]-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-ol |
|---|---|
| PubChem CID | 11251211 |
| Molecular Formula | C47H54O6Si |
| Molecular Weight | 743.03 g/mol |
| Exact Mass | 742.37 |
| IUPAC Name | (2R,3S,4R,5R,6R)-2-[(E)-4-[tert-butyl(diphenyl)silyl]oxybut-1-enyl]-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-ol |
| SMILES | CC(C)(C)[Si](OCC/C=C/[C@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C47H54O6Si/c1-47(2,3)54(40-27-15-7-16-28-40,41-29-17-8-18-30-41)52-32-20-19-31-42-44(48)46(51-35-39-25-13-6-14-26-39)45(50-34-38-23-11-5-12-24-38)43(53-42)36-49-33-37-21-9-4-10-22-37/h4-19,21-31,42-46,48H,20,32-36H2,1-3H3/b31-19+/t42-,43-,44+,45-,46-/m1/s1 |
| InChIKey | YHXCVJNEURZJIS-ABLLPDKBSA-N |
| XLogP | 8.03 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.03 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|