C32H41IO4Si — CID 134844367
tert-butyl-[2-[(2R,3R,4R,5R)-2-(iodomethyl)-4-methoxy-5-(phenylmethoxymethyl)oxolan-3-yl]ethoxy]-diphenylsilane (PubChem CID 134844367) has the molecular formula C32H41IO4Si and a molecular weight of 644.67 g/mol. Its IUPAC name is tert-butyl-[2-[(2R,3R,4R,5R)-2-(iodomethyl)-4-methoxy-5-(phenylmethoxymethyl)oxolan-3-yl]ethoxy]-diphenylsilane.
| Compound Name | tert-butyl-[2-[(2R,3R,4R,5R)-2-(iodomethyl)-4-methoxy-5-(phenylmethoxymethyl)oxolan-3-yl]ethoxy]-diphenylsilane |
|---|---|
| PubChem CID | 134844367 |
| Molecular Formula | C32H41IO4Si |
| Molecular Weight | 644.67 g/mol |
| Exact Mass | 644.18 |
| IUPAC Name | tert-butyl-[2-[(2R,3R,4R,5R)-2-(iodomethyl)-4-methoxy-5-(phenylmethoxymethyl)oxolan-3-yl]ethoxy]-diphenylsilane |
| SMILES | CO[C@@H]1[C@@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H](CI)O[C@@H]1COCc1ccccc1 |
| InChI | InChI=1S/C32H41IO4Si/c1-32(2,3)38(26-16-10-6-11-17-26,27-18-12-7-13-19-27)36-21-20-28-29(22-33)37-30(31(28)34-4)24-35-23-25-14-8-5-9-15-25/h5-19,28-31H,20-24H2,1-4H3/t28-,29-,30+,31+/m0/s1 |
| InChIKey | GYCRQIZLIGDCFA-SYQUUIDJSA-N |
| XLogP | 6.00 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.67 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|