C32H42O4Si — CID 11214535
tert-butyl-[2-[(4S,6R)-2,2-dimethyl-6-(phenylmethoxymethyl)-1,3-dioxan-4-yl]ethoxy]-diphenylsilane (PubChem CID 11214535) has the molecular formula C32H42O4Si and a molecular weight of 518.77 g/mol. Its IUPAC name is tert-butyl-[2-[(4S,6R)-2,2-dimethyl-6-(phenylmethoxymethyl)-1,3-dioxan-4-yl]ethoxy]-diphenylsilane.
| Compound Name | tert-butyl-[2-[(4S,6R)-2,2-dimethyl-6-(phenylmethoxymethyl)-1,3-dioxan-4-yl]ethoxy]-diphenylsilane |
|---|---|
| PubChem CID | 11214535 |
| Molecular Formula | C32H42O4Si |
| Molecular Weight | 518.77 g/mol |
| Exact Mass | 518.29 |
| IUPAC Name | tert-butyl-[2-[(4S,6R)-2,2-dimethyl-6-(phenylmethoxymethyl)-1,3-dioxan-4-yl]ethoxy]-diphenylsilane |
| SMILES | CC1(C)O[C@@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C[C@H](COCc2ccccc2)O1 |
| InChI | InChI=1S/C32H42O4Si/c1-31(2,3)37(29-17-11-7-12-18-29,30-19-13-8-14-20-30)34-22-21-27-23-28(36-32(4,5)35-27)25-33-24-26-15-9-6-10-16-26/h6-20,27-28H,21-25H2,1-5H3/t27-,28+/m0/s1 |
| InChIKey | QKWAXDGVEKQPNQ-WUFINQPMSA-N |
| XLogP | 6.08 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.77 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|