C19H28O5 — CID 71481945
2-[(4S,6S)-2,2-dimethyl-6-(2-phenylmethoxyethyl)-1,3-dioxan-4-yl]ethyl acetate (PubChem CID 71481945) has the molecular formula C19H28O5 and a molecular weight of 336.43 g/mol. Its IUPAC name is 2-[(4S,6S)-2,2-dimethyl-6-(2-phenylmethoxyethyl)-1,3-dioxan-4-yl]ethyl acetate.
| Compound Name | 2-[(4S,6S)-2,2-dimethyl-6-(2-phenylmethoxyethyl)-1,3-dioxan-4-yl]ethyl acetate |
|---|---|
| PubChem CID | 71481945 |
| Molecular Formula | C19H28O5 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | 2-[(4S,6S)-2,2-dimethyl-6-(2-phenylmethoxyethyl)-1,3-dioxan-4-yl]ethyl acetate |
| SMILES | CC(=O)OCC[C@H]1C[C@H](CCOCc2ccccc2)OC(C)(C)O1 |
| InChI | InChI=1S/C19H28O5/c1-15(20)22-12-10-18-13-17(23-19(2,3)24-18)9-11-21-14-16-7-5-4-6-8-16/h4-8,17-18H,9-14H2,1-3H3/t17-,18-/m0/s1 |
| InChIKey | SMGLHGSOFVRCJD-ROUUACIJSA-N |
| XLogP | 3.46 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|