C18H23F3O5 — CID 10384885
[(1R)-1-[(4R,5S)-2,2-dimethyl-5-(2-phenylmethoxyethyl)-1,3-dioxolan-4-yl]-2,2,2-trifluoroethyl] acetate (PubChem CID 10384885) has the molecular formula C18H23F3O5 and a molecular weight of 376.37 g/mol. Its IUPAC name is [(1R)-1-[(4R,5S)-2,2-dimethyl-5-(2-phenylmethoxyethyl)-1,3-dioxolan-4-yl]-2,2,2-trifluoroethyl] acetate.
| Compound Name | [(1R)-1-[(4R,5S)-2,2-dimethyl-5-(2-phenylmethoxyethyl)-1,3-dioxolan-4-yl]-2,2,2-trifluoroethyl] acetate |
|---|---|
| PubChem CID | 10384885 |
| Molecular Formula | C18H23F3O5 |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | [(1R)-1-[(4R,5S)-2,2-dimethyl-5-(2-phenylmethoxyethyl)-1,3-dioxolan-4-yl]-2,2,2-trifluoroethyl] acetate |
| SMILES | CC(=O)O[C@H]([C@@H]1OC(C)(C)O[C@H]1CCOCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C18H23F3O5/c1-12(22)24-16(18(19,20)21)15-14(25-17(2,3)26-15)9-10-23-11-13-7-5-4-6-8-13/h4-8,14-16H,9-11H2,1-3H3/t14-,15+,16+/m0/s1 |
| InChIKey | DEFMLOZUHVVFDQ-ARFHVFGLSA-N |
| XLogP | 3.61 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|