C40H48O4 — CID 102077008
(4S,5R,6S)-2,2,5-trimethyl-4-[(2R)-5-phenylmethoxypentan-2-yl]-6-(2-trityloxyethyl)-1,3-dioxane (PubChem CID 102077008) has the molecular formula C40H48O4 and a molecular weight of 592.82 g/mol. Its IUPAC name is (4S,5R,6S)-2,2,5-trimethyl-4-[(2R)-5-phenylmethoxypentan-2-yl]-6-(2-trityloxyethyl)-1,3-dioxane.
| Compound Name | (4S,5R,6S)-2,2,5-trimethyl-4-[(2R)-5-phenylmethoxypentan-2-yl]-6-(2-trityloxyethyl)-1,3-dioxane |
|---|---|
| PubChem CID | 102077008 |
| Molecular Formula | C40H48O4 |
| Molecular Weight | 592.82 g/mol |
| Exact Mass | 592.36 |
| IUPAC Name | (4S,5R,6S)-2,2,5-trimethyl-4-[(2R)-5-phenylmethoxypentan-2-yl]-6-(2-trityloxyethyl)-1,3-dioxane |
| SMILES | C[C@H]1[C@H]([C@H](C)CCCOCc2ccccc2)OC(C)(C)O[C@H]1CCOC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H48O4/c1-31(18-17-28-41-30-33-19-9-5-10-20-33)38-32(2)37(43-39(3,4)44-38)27-29-42-40(34-21-11-6-12-22-34,35-23-13-7-14-24-35)36-25-15-8-16-26-36/h5-16,19-26,31-32,37-38H,17-18,27-30H2,1-4H3/t31-,32-,37+,38+/m1/s1 |
| InChIKey | CCXQZRLJMDMTSZ-RGXXHLTKSA-N |
| XLogP | 9.17 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.82 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|