C22H36O3 — CID 11089376
(5R)-2,2,4,4-tetramethyl-5-[(5S)-5-methyl-7-phenylmethoxyheptyl]-1,3-dioxolane (PubChem CID 11089376) has the molecular formula C22H36O3 and a molecular weight of 348.53 g/mol. Its IUPAC name is (5R)-2,2,4,4-tetramethyl-5-[(5S)-5-methyl-7-phenylmethoxyheptyl]-1,3-dioxolane.
| Compound Name | (5R)-2,2,4,4-tetramethyl-5-[(5S)-5-methyl-7-phenylmethoxyheptyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 11089376 |
| Molecular Formula | C22H36O3 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.27 |
| IUPAC Name | (5R)-2,2,4,4-tetramethyl-5-[(5S)-5-methyl-7-phenylmethoxyheptyl]-1,3-dioxolane |
| SMILES | C[C@@H](CCCC[C@H]1OC(C)(C)OC1(C)C)CCOCc1ccccc1 |
| InChI | InChI=1S/C22H36O3/c1-18(15-16-23-17-19-12-7-6-8-13-19)11-9-10-14-20-21(2,3)25-22(4,5)24-20/h6-8,12-13,18,20H,9-11,14-17H2,1-5H3/t18-,20+/m0/s1 |
| InChIKey | HYRYEEBOOSXZIP-AZUAARDMSA-N |
| XLogP | 5.72 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|