C21H34O3 — CID 56594681
(4R,5R)-4-heptyl-2,2-dimethyl-5-(2-phenylmethoxyethyl)-1,3-dioxolane (PubChem CID 56594681) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is (4R,5R)-4-heptyl-2,2-dimethyl-5-(2-phenylmethoxyethyl)-1,3-dioxolane.
| Compound Name | (4R,5R)-4-heptyl-2,2-dimethyl-5-(2-phenylmethoxyethyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 56594681 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | (4R,5R)-4-heptyl-2,2-dimethyl-5-(2-phenylmethoxyethyl)-1,3-dioxolane |
| SMILES | CCCCCCC[C@H]1OC(C)(C)O[C@@H]1CCOCc1ccccc1 |
| InChI | InChI=1S/C21H34O3/c1-4-5-6-7-11-14-19-20(24-21(2,3)23-19)15-16-22-17-18-12-9-8-10-13-18/h8-10,12-13,19-20H,4-7,11,14-17H2,1-3H3/t19-,20-/m1/s1 |
| InChIKey | TUSNUOBYNPMVLM-WOJBJXKFSA-N |
| XLogP | 5.47 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|