C16H21F3O4 — CID 10426992
(4S,5S,6S)-2,2-dimethyl-4-(2-phenylmethoxyethyl)-6-(trifluoromethyl)-1,3-dioxan-5-ol (PubChem CID 10426992) has the molecular formula C16H21F3O4 and a molecular weight of 334.33 g/mol. Its IUPAC name is (4S,5S,6S)-2,2-dimethyl-4-(2-phenylmethoxyethyl)-6-(trifluoromethyl)-1,3-dioxan-5-ol.
| Compound Name | (4S,5S,6S)-2,2-dimethyl-4-(2-phenylmethoxyethyl)-6-(trifluoromethyl)-1,3-dioxan-5-ol |
|---|---|
| PubChem CID | 10426992 |
| Molecular Formula | C16H21F3O4 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | (4S,5S,6S)-2,2-dimethyl-4-(2-phenylmethoxyethyl)-6-(trifluoromethyl)-1,3-dioxan-5-ol |
| SMILES | CC1(C)O[C@@H](CCOCc2ccccc2)[C@H](O)[C@@H](C(F)(F)F)O1 |
| InChI | InChI=1S/C16H21F3O4/c1-15(2)22-12(13(20)14(23-15)16(17,18)19)8-9-21-10-11-6-4-3-5-7-11/h3-7,12-14,20H,8-10H2,1-2H3/t12-,13-,14-/m0/s1 |
| InChIKey | PAPTWQDYPOYVGL-IHRRRGAJSA-N |
| XLogP | 3.04 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|