C21H26O4 — CID 46918773
(R)-[(4R,5S)-2,2-dimethyl-5-(2-phenylmethoxyethyl)-1,3-dioxolan-4-yl]-phenylmethanol (PubChem CID 46918773) has the molecular formula C21H26O4 and a molecular weight of 342.44 g/mol. Its IUPAC name is (R)-[(4R,5S)-2,2-dimethyl-5-(2-phenylmethoxyethyl)-1,3-dioxolan-4-yl]-phenylmethanol.
| Compound Name | (R)-[(4R,5S)-2,2-dimethyl-5-(2-phenylmethoxyethyl)-1,3-dioxolan-4-yl]-phenylmethanol |
|---|---|
| PubChem CID | 46918773 |
| Molecular Formula | C21H26O4 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | (R)-[(4R,5S)-2,2-dimethyl-5-(2-phenylmethoxyethyl)-1,3-dioxolan-4-yl]-phenylmethanol |
| SMILES | CC1(C)O[C@H]([C@H](O)c2ccccc2)[C@H](CCOCc2ccccc2)O1 |
| InChI | InChI=1S/C21H26O4/c1-21(2)24-18(13-14-23-15-16-9-5-3-6-10-16)20(25-21)19(22)17-11-7-4-8-12-17/h3-12,18-20,22H,13-15H2,1-2H3/t18-,19+,20-/m0/s1 |
| InChIKey | UCDHYYIANKQWNS-ZCNNSNEGSA-N |
| XLogP | 3.85 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|