C18H20O3 — CID 102281687
(R)-phenyl-[(2S,3R)-3-(2-phenylmethoxyethyl)oxiran-2-yl]methanol (PubChem CID 102281687) has the molecular formula C18H20O3 and a molecular weight of 284.36 g/mol. Its IUPAC name is (R)-phenyl-[(2S,3R)-3-(2-phenylmethoxyethyl)oxiran-2-yl]methanol.
| Compound Name | (R)-phenyl-[(2S,3R)-3-(2-phenylmethoxyethyl)oxiran-2-yl]methanol |
|---|---|
| PubChem CID | 102281687 |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | (R)-phenyl-[(2S,3R)-3-(2-phenylmethoxyethyl)oxiran-2-yl]methanol |
| SMILES | O[C@H](c1ccccc1)[C@@H]1O[C@@H]1CCOCc1ccccc1 |
| InChI | InChI=1S/C18H20O3/c19-17(15-9-5-2-6-10-15)18-16(21-18)11-12-20-13-14-7-3-1-4-8-14/h1-10,16-19H,11-13H2/t16-,17-,18-/m1/s1 |
| InChIKey | QPKYMBXXYZWXIO-KZNAEPCWSA-N |
| XLogP | 3.09 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|