C21H24O5 — CID 102597561
bis[(2R,3R)-3-(phenylmethoxymethyl)oxiran-2-yl]methanol (PubChem CID 102597561) has the molecular formula C21H24O5 and a molecular weight of 356.42 g/mol. Its IUPAC name is bis[(2R,3R)-3-(phenylmethoxymethyl)oxiran-2-yl]methanol.
| Compound Name | bis[(2R,3R)-3-(phenylmethoxymethyl)oxiran-2-yl]methanol |
|---|---|
| PubChem CID | 102597561 |
| Molecular Formula | C21H24O5 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | bis[(2R,3R)-3-(phenylmethoxymethyl)oxiran-2-yl]methanol |
| SMILES | OC([C@H]1O[C@@H]1COCc1ccccc1)[C@H]1O[C@@H]1COCc1ccccc1 |
| InChI | InChI=1S/C21H24O5/c22-19(20-17(25-20)13-23-11-15-7-3-1-4-8-15)21-18(26-21)14-24-12-16-9-5-2-6-10-16/h1-10,17-22H,11-14H2/t17-,18-,20+,21+/m1/s1 |
| InChIKey | PWZFUPSEIWTOFC-QCFAMHMHSA-N |
| XLogP | 2.32 |
| TPSA | 63.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|