C12H15BrO3 — CID 10869903
(1R)-1-[(2S,3R)-3-[(4-bromophenyl)methoxymethyl]oxiran-2-yl]ethanol (PubChem CID 10869903) has the molecular formula C12H15BrO3 and a molecular weight of 287.15 g/mol. Its IUPAC name is (1R)-1-[(2S,3R)-3-[(4-bromophenyl)methoxymethyl]oxiran-2-yl]ethanol.
| Compound Name | (1R)-1-[(2S,3R)-3-[(4-bromophenyl)methoxymethyl]oxiran-2-yl]ethanol |
|---|---|
| PubChem CID | 10869903 |
| Molecular Formula | C12H15BrO3 |
| Molecular Weight | 287.15 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | (1R)-1-[(2S,3R)-3-[(4-bromophenyl)methoxymethyl]oxiran-2-yl]ethanol |
| SMILES | C[C@@H](O)[C@@H]1O[C@@H]1COCc1ccc(Br)cc1 |
| InChI | InChI=1S/C12H15BrO3/c1-8(14)12-11(16-12)7-15-6-9-2-4-10(13)5-3-9/h2-5,8,11-12,14H,6-7H2,1H3/t8-,11-,12+/m1/s1 |
| InChIKey | WPTXDDBIQZOIBR-FXAINCCUSA-N |
| XLogP | 2.11 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.15 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|