C19H20BrNO2 — CID 11046989
1-[(2R,3S)-3-[(4-bromophenyl)methoxymethyl]oxiran-2-yl]-N-[(1S)-1-phenylethyl]methanimine (PubChem CID 11046989) has the molecular formula C19H20BrNO2 and a molecular weight of 374.28 g/mol. Its IUPAC name is 1-[(2R,3S)-3-[(4-bromophenyl)methoxymethyl]oxiran-2-yl]-N-[(1S)-1-phenylethyl]methanimine.
| Compound Name | 1-[(2R,3S)-3-[(4-bromophenyl)methoxymethyl]oxiran-2-yl]-N-[(1S)-1-phenylethyl]methanimine |
|---|---|
| PubChem CID | 11046989 |
| Molecular Formula | C19H20BrNO2 |
| Molecular Weight | 374.28 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | 1-[(2R,3S)-3-[(4-bromophenyl)methoxymethyl]oxiran-2-yl]-N-[(1S)-1-phenylethyl]methanimine |
| SMILES | C[C@H](/N=C/[C@H]1O[C@H]1COCc1ccc(Br)cc1)c1ccccc1 |
| InChI | InChI=1S/C19H20BrNO2/c1-14(16-5-3-2-4-6-16)21-11-18-19(23-18)13-22-12-15-7-9-17(20)10-8-15/h2-11,14,18-19H,12-13H2,1H3/b21-11+/t14-,18+,19-/m0/s1 |
| InChIKey | YSTHUEGSJBEHJN-FENFVLOBSA-N |
| XLogP | 4.57 |
| TPSA | 34.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.28 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|