C16H15BrO2 — CID 135762701
(2R,3S)-2-(4-bromophenyl)-3-(phenylmethoxymethyl)oxirane (PubChem CID 135762701) has the molecular formula C16H15BrO2 and a molecular weight of 319.20 g/mol. Its IUPAC name is (2R,3S)-2-(4-bromophenyl)-3-(phenylmethoxymethyl)oxirane.
| Compound Name | (2R,3S)-2-(4-bromophenyl)-3-(phenylmethoxymethyl)oxirane |
|---|---|
| PubChem CID | 135762701 |
| Molecular Formula | C16H15BrO2 |
| Molecular Weight | 319.20 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | (2R,3S)-2-(4-bromophenyl)-3-(phenylmethoxymethyl)oxirane |
| SMILES | Brc1ccc([C@H]2O[C@H]2COCc2ccccc2)cc1 |
| InChI | InChI=1S/C16H15BrO2/c17-14-8-6-13(7-9-14)16-15(19-16)11-18-10-12-4-2-1-3-5-12/h1-9,15-16H,10-11H2/t15-,16+/m0/s1 |
| InChIKey | GCVYZVOXQRWFIK-JKSUJKDBSA-N |
| XLogP | 4.11 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.20 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|