C13H20O2Si — CID 11736511
trimethyl-[(2S,3S)-3-(phenylmethoxymethyl)oxiran-2-yl]silane (PubChem CID 11736511) has the molecular formula C13H20O2Si and a molecular weight of 236.39 g/mol. Its IUPAC name is trimethyl-[(2S,3S)-3-(phenylmethoxymethyl)oxiran-2-yl]silane.
| Compound Name | trimethyl-[(2S,3S)-3-(phenylmethoxymethyl)oxiran-2-yl]silane |
|---|---|
| PubChem CID | 11736511 |
| Molecular Formula | C13H20O2Si |
| Molecular Weight | 236.39 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | trimethyl-[(2S,3S)-3-(phenylmethoxymethyl)oxiran-2-yl]silane |
| SMILES | C[Si](C)(C)[C@@H]1O[C@H]1COCc1ccccc1 |
| InChI | InChI=1S/C13H20O2Si/c1-16(2,3)13-12(15-13)10-14-9-11-7-5-4-6-8-11/h4-8,12-13H,9-10H2,1-3H3/t12-,13-/m0/s1 |
| InChIKey | CGMGJLBLCGOPCO-STQMWFEESA-N |
| XLogP | 2.85 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.39 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|