C22H28O3Si — CID 12020935
(3R,4S,5S)-3-benzyl-5-(phenylmethoxymethyl)-4-trimethylsilyloxolan-2-one (PubChem CID 12020935) has the molecular formula C22H28O3Si and a molecular weight of 368.55 g/mol. Its IUPAC name is (3R,4S,5S)-3-benzyl-5-(phenylmethoxymethyl)-4-trimethylsilyloxolan-2-one.
| Compound Name | (3R,4S,5S)-3-benzyl-5-(phenylmethoxymethyl)-4-trimethylsilyloxolan-2-one |
|---|---|
| PubChem CID | 12020935 |
| Molecular Formula | C22H28O3Si |
| Molecular Weight | 368.55 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | (3R,4S,5S)-3-benzyl-5-(phenylmethoxymethyl)-4-trimethylsilyloxolan-2-one |
| SMILES | C[Si](C)(C)[C@@H]1[C@H](COCc2ccccc2)OC(=O)[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C22H28O3Si/c1-26(2,3)21-19(14-17-10-6-4-7-11-17)22(23)25-20(21)16-24-15-18-12-8-5-9-13-18/h4-13,19-21H,14-16H2,1-3H3/t19-,20-,21-/m0/s1 |
| InChIKey | DBLVQCKMKKXXSA-ACRUOGEOSA-N |
| XLogP | 4.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.55 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|