C34H34O6 — CID 134832144
(5S)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-one (PubChem CID 134832144) has the molecular formula C34H34O6 and a molecular weight of 538.64 g/mol. Its IUPAC name is (5S)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-one.
| Compound Name | (5S)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-one |
|---|---|
| PubChem CID | 134832144 |
| Molecular Formula | C34H34O6 |
| Molecular Weight | 538.64 g/mol |
| Exact Mass | 538.24 |
| IUPAC Name | (5S)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-one |
| SMILES | O=C1OC(COCc2ccccc2)[C@H](OCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C34H34O6/c35-34-33(39-24-29-19-11-4-12-20-29)32(38-23-28-17-9-3-10-18-28)31(37-22-27-15-7-2-8-16-27)30(40-34)25-36-21-26-13-5-1-6-14-26/h1-20,30-33H,21-25H2/t30?,31-,32?,33?/m0/s1 |
| InChIKey | BUBVLQDEIIUIQG-WNXYDGTBSA-N |
| XLogP | 5.88 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.64 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |