C40H44O5Si — CID 102072085
trimethyl-[(3Z)-3-[(3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ylidene]prop-1-ynyl]silane (PubChem CID 102072085) has the molecular formula C40H44O5Si and a molecular weight of 632.87 g/mol. Its IUPAC name is trimethyl-[(3Z)-3-[(3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ylidene]prop-1-ynyl]silane.
| Compound Name | trimethyl-[(3Z)-3-[(3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ylidene]prop-1-ynyl]silane |
|---|---|
| PubChem CID | 102072085 |
| Molecular Formula | C40H44O5Si |
| Molecular Weight | 632.87 g/mol |
| Exact Mass | 632.30 |
| IUPAC Name | trimethyl-[(3Z)-3-[(3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ylidene]prop-1-ynyl]silane |
| SMILES | C[Si](C)(C)C#C/C=C1\O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C40H44O5Si/c1-46(2,3)26-16-25-36-38(42-28-33-19-10-5-11-20-33)40(44-30-35-23-14-7-15-24-35)39(43-29-34-21-12-6-13-22-34)37(45-36)31-41-27-32-17-8-4-9-18-32/h4-15,17-25,37-40H,27-31H2,1-3H3/b36-25-/t37-,38+,39-,40-/m1/s1 |
| InChIKey | XXFDSCKIFLTPRH-AXEKRYAXSA-N |
| XLogP | 8.12 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.87 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|