C38H40O7 — CID 101238772
[(1Z)-1-[(3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ylidene]ethyl] acetate (PubChem CID 101238772) has the molecular formula C38H40O7 and a molecular weight of 608.73 g/mol. Its IUPAC name is [(1Z)-1-[(3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ylidene]ethyl] acetate.
| Compound Name | [(1Z)-1-[(3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ylidene]ethyl] acetate |
|---|---|
| PubChem CID | 101238772 |
| Molecular Formula | C38H40O7 |
| Molecular Weight | 608.73 g/mol |
| Exact Mass | 608.28 |
| IUPAC Name | [(1Z)-1-[(3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ylidene]ethyl] acetate |
| SMILES | CC(=O)O/C(C)=C1\O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C38H40O7/c1-28(44-29(2)39)35-37(42-25-32-19-11-5-12-20-32)38(43-26-33-21-13-6-14-22-33)36(41-24-31-17-9-4-10-18-31)34(45-35)27-40-23-30-15-7-3-8-16-30/h3-22,34,36-38H,23-27H2,1-2H3/b35-28-/t34-,36-,37+,38+/m1/s1 |
| InChIKey | ZVGNCXQTVBAODJ-YCVRUMBYSA-N |
| XLogP | 7.15 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.73 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|